C23H20ClFN4O2 — CID 143967256
(E)-3-[3-[2-(3-chloro-5-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enal (PubChem CID 143967256) has the molecular formula C23H20ClFN4O2 and a molecular weight of 438.89 g/mol. Its IUPAC name is (E)-3-[3-[2-(3-chloro-5-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enal.
| Compound Name | (E)-3-[3-[2-(3-chloro-5-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 143967256 |
| Molecular Formula | C23H20ClFN4O2 |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (E)-3-[3-[2-(3-chloro-5-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enal |
| SMILES | O=C/C=C/c1cccc(-c2cnc(Nc3cc(F)cc(Cl)c3)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H20ClFN4O2/c24-18-12-19(25)14-20(13-18)27-23-26-15-21(22(28-23)29-6-9-31-10-7-29)17-5-1-3-16(11-17)4-2-8-30/h1-5,8,11-15H,6-7,9-10H2,(H,26,27,28)/b4-2+ |
| InChIKey | CSWNPSPASJJTRZ-DUXPYHPUSA-N |
| XLogP | 4.73 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|