C17H15ClN3O3- — CID 86642205
(E)-3-[3-(2-chloro-4-morpholin-4-ylpyrimidin-5-yl)phenyl]prop-2-enoate (PubChem CID 86642205) has the molecular formula C17H15ClN3O3- and a molecular weight of 344.78 g/mol. Its IUPAC name is (E)-3-[3-(2-chloro-4-morpholin-4-ylpyrimidin-5-yl)phenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-(2-chloro-4-morpholin-4-ylpyrimidin-5-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86642205 |
| Molecular Formula | C17H15ClN3O3- |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (E)-3-[3-(2-chloro-4-morpholin-4-ylpyrimidin-5-yl)phenyl]prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1cccc(-c2cnc(Cl)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C17H16ClN3O3/c18-17-19-11-14(16(20-17)21-6-8-24-9-7-21)13-3-1-2-12(10-13)4-5-15(22)23/h1-5,10-11H,6-9H2,(H,22,23)/p-1/b5-4+ |
| InChIKey | DALQJWDZXUGTPA-SNAWJCMRSA-M |
| XLogP | 1.40 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|