C27H28FN5O6S — CID 59354526
(E)-3-[3-[2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 59354526) has the molecular formula C27H28FN5O6S and a molecular weight of 569.62 g/mol. Its IUPAC name is (E)-3-[3-[2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59354526 |
| Molecular Formula | C27H28FN5O6S |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | (E)-3-[3-[2-(4-fluoro-3-morpholin-4-ylsulfonylanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cnc(Nc3ccc(F)c(S(=O)(=O)N4CCOCC4)c3)nc2N2CCOCC2)c1 |
| InChI | InChI=1S/C27H28FN5O6S/c28-23-6-5-21(17-24(23)40(36,37)33-10-14-39-15-11-33)30-27-29-18-22(26(31-27)32-8-12-38-13-9-32)20-3-1-2-19(16-20)4-7-25(34)35/h1-7,16-18H,8-15H2,(H,34,35)(H,29,30,31)/b7-4+ |
| InChIKey | BFJWTBUQHPIREG-QPJJXVBHSA-N |
| XLogP | 2.98 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|