C24H20FN5O3 — CID 68641737
3-[3-[2-(3-cyano-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 68641737) has the molecular formula C24H20FN5O3 and a molecular weight of 445.45 g/mol. Its IUPAC name is 3-[3-[2-(3-cyano-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(3-cyano-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68641737 |
| Molecular Formula | C24H20FN5O3 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-[3-[2-(3-cyano-4-fluoroanilino)-4-morpholin-4-ylpyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | N#Cc1cc(Nc2ncc(-c3cccc(C=CC(=O)O)c3)c(N3CCOCC3)n2)ccc1F |
| InChI | InChI=1S/C24H20FN5O3/c25-21-6-5-19(13-18(21)14-26)28-24-27-15-20(23(29-24)30-8-10-33-11-9-30)17-3-1-2-16(12-17)4-7-22(31)32/h1-7,12-13,15H,8-11H2,(H,31,32)(H,27,28,29) |
| InChIKey | VTFBZGQYKMVMCN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|