C23H18ClFN6O2 — CID 59353625
ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(triazol-2-yl)pyrimidin-5-yl]phenyl]prop-2-enoate (PubChem CID 59353625) has the molecular formula C23H18ClFN6O2 and a molecular weight of 464.89 g/mol. Its IUPAC name is ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(triazol-2-yl)pyrimidin-5-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(triazol-2-yl)pyrimidin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59353625 |
| Molecular Formula | C23H18ClFN6O2 |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | ethyl (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(triazol-2-yl)pyrimidin-5-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2-n2nccn2)c1 |
| InChI | InChI=1S/C23H18ClFN6O2/c1-2-33-21(32)9-6-15-4-3-5-16(12-15)18-14-26-23(30-22(18)31-27-10-11-28-31)29-17-7-8-20(25)19(24)13-17/h3-14H,2H2,1H3,(H,26,29,30)/b9-6+ |
| InChIKey | UTABDMNNACPGEF-RMKNXTFCSA-N |
| XLogP | 4.84 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|