C27H24F3N5O2 — CID 59353197
ethyl (E)-3-[3-[2-(3,5-dimethylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoate (PubChem CID 59353197) has the molecular formula C27H24F3N5O2 and a molecular weight of 507.52 g/mol. Its IUPAC name is ethyl (E)-3-[3-[2-(3,5-dimethylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[2-(3,5-dimethylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59353197 |
| Molecular Formula | C27H24F3N5O2 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | ethyl (E)-3-[3-[2-(3,5-dimethylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2cnc(Nc3cc(C)cc(C)c3)nc2-n2ccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C27H24F3N5O2/c1-4-37-24(36)9-8-19-6-5-7-20(15-19)22-16-31-26(32-21-13-17(2)12-18(3)14-21)33-25(22)35-11-10-23(34-35)27(28,29)30/h5-16H,4H2,1-3H3,(H,31,32,33)/b9-8+ |
| InChIKey | IKLOHRLKEPZKNP-CMDGGOBGSA-N |
| XLogP | 6.28 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|