C24H18F3N5O2 — CID 59353908
(E)-3-[3-[2-(3-methylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 59353908) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is (E)-3-[3-[2-(3-methylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(3-methylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59353908 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (E)-3-[3-[2-(3-methylanilino)-4-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cccc(Nc2ncc(-c3cccc(/C=C/C(=O)O)c3)c(-n3ccc(C(F)(F)F)n3)n2)c1 |
| InChI | InChI=1S/C24H18F3N5O2/c1-15-4-2-7-18(12-15)29-23-28-14-19(17-6-3-5-16(13-17)8-9-21(33)34)22(30-23)32-11-10-20(31-32)24(25,26)27/h2-14H,1H3,(H,33,34)(H,28,29,30)/b9-8+ |
| InChIKey | OGKXWFXBZHOGBW-CMDGGOBGSA-N |
| XLogP | 5.50 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|