C24H17F4N5O2 — CID 68647234
3-[3-[2-(3-fluoroanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 68647234) has the molecular formula C24H17F4N5O2 and a molecular weight of 483.43 g/mol. Its IUPAC name is 3-[3-[2-(3-fluoroanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(3-fluoroanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68647234 |
| Molecular Formula | C24H17F4N5O2 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3-[3-[2-(3-fluoroanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C(F)(F)F)nn1-c1nc(Nc2cccc(F)c2)ncc1-c1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C24H17F4N5O2/c1-14-10-20(24(26,27)28)32-33(14)22-19(16-5-2-4-15(11-16)8-9-21(34)35)13-29-23(31-22)30-18-7-3-6-17(25)12-18/h2-13H,1H3,(H,34,35)(H,29,30,31) |
| InChIKey | USAOGTHQFQBESR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|