C28H31ClFN7O3 — CID 68647099
3-[3-[2-(3-chloro-4-fluoroanilino)-4-[3-[(5-methylpiperazine-2-carbonyl)amino]propylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 68647099) has the molecular formula C28H31ClFN7O3 and a molecular weight of 568.05 g/mol. Its IUPAC name is 3-[3-[2-(3-chloro-4-fluoroanilino)-4-[3-[(5-methylpiperazine-2-carbonyl)amino]propylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[2-(3-chloro-4-fluoroanilino)-4-[3-[(5-methylpiperazine-2-carbonyl)amino]propylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68647099 |
| Molecular Formula | C28H31ClFN7O3 |
| Molecular Weight | 568.05 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 3-[3-[2-(3-chloro-4-fluoroanilino)-4-[3-[(5-methylpiperazine-2-carbonyl)amino]propylamino]pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | CC1CNC(C(=O)NCCCNc2nc(Nc3ccc(F)c(Cl)c3)ncc2-c2cccc(C=CC(=O)O)c2)CN1 |
| InChI | InChI=1S/C28H31ClFN7O3/c1-17-14-34-24(16-33-17)27(40)32-11-3-10-31-26-21(19-5-2-4-18(12-19)6-9-25(38)39)15-35-28(37-26)36-20-7-8-23(30)22(29)13-20/h2,4-9,12-13,15,17,24,33-34H,3,10-11,14,16H2,1H3,(H,32,40)(H,38,39)(H2,31,35,36,37) |
| InChIKey | CJJVGLNWNGDOKT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.05 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|