C27H24F3N5O4S — CID 158334206
4-[N-methyl-4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]propyl]anilino]-2-[2-(sulfinoamino)anilino]pyrimidine (PubChem CID 158334206) has the molecular formula C27H24F3N5O4S and a molecular weight of 571.58 g/mol. Its IUPAC name is 4-[N-methyl-4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]propyl]anilino]-2-[2-(sulfinoamino)anilino]pyrimidine.
| Compound Name | 4-[N-methyl-4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]propyl]anilino]-2-[2-(sulfinoamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 158334206 |
| Molecular Formula | C27H24F3N5O4S |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 4-[N-methyl-4-[2-oxo-3-[4-(trifluoromethoxy)phenyl]propyl]anilino]-2-[2-(sulfinoamino)anilino]pyrimidine |
| SMILES | CN(c1ccc(CC(=O)Cc2ccc(OC(F)(F)F)cc2)cc1)c1ccnc(Nc2ccccc2NS(=O)O)n1 |
| InChI | InChI=1S/C27H24F3N5O4S/c1-35(25-14-15-31-26(33-25)32-23-4-2-3-5-24(23)34-40(37)38)20-10-6-18(7-11-20)16-21(36)17-19-8-12-22(13-9-19)39-27(28,29)30/h2-15,34H,16-17H2,1H3,(H,37,38)(H,31,32,33) |
| InChIKey | AKIMVQOXFQKKPF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|