C21H21N5O3 — CID 118034141
N-[2-[[4-(3-hydroxy-5-methoxy-N-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 118034141) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[2-[[4-(3-hydroxy-5-methoxy-N-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[4-(3-hydroxy-5-methoxy-N-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118034141 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[2-[[4-(3-hydroxy-5-methoxy-N-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nccc(N(C)c2cc(O)cc(OC)c2)n1 |
| InChI | InChI=1S/C21H21N5O3/c1-4-20(28)23-17-7-5-6-8-18(17)24-21-22-10-9-19(25-21)26(2)14-11-15(27)13-16(12-14)29-3/h4-13,27H,1H2,2-3H3,(H,23,28)(H,22,24,25) |
| InChIKey | VLDWZBSFPGUJCH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|