C27H32N6O4 — CID 141418191
N-[2-[[2-[2-methoxy-4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 141418191) has the molecular formula C27H32N6O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[2-[[2-[2-methoxy-4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[2-[2-methoxy-4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 141418191 |
| Molecular Formula | C27H32N6O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | N-[2-[[2-[2-methoxy-4-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1ccnc(Nc2ccc(OCCCN3CCOCC3)cc2OC)n1 |
| InChI | InChI=1S/C27H32N6O4/c1-3-26(34)30-22-8-5-4-7-21(22)29-25-11-12-28-27(32-25)31-23-10-9-20(19-24(23)35-2)37-16-6-13-33-14-17-36-18-15-33/h3-5,7-12,19H,1,6,13-18H2,2H3,(H,30,34)(H2,28,29,31,32) |
| InChIKey | TVWLMCMONJTNSW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|