C27H33N8O5+ — CID 123499700
2-[[3-methoxy-1-(3-morpholin-4-ylpropoxy)pyridin-1-ium-4-yl]amino]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide (PubChem CID 123499700) has the molecular formula C27H33N8O5+ and a molecular weight of 549.61 g/mol. Its IUPAC name is 2-[[3-methoxy-1-(3-morpholin-4-ylpropoxy)pyridin-1-ium-4-yl]amino]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-[[3-methoxy-1-(3-morpholin-4-ylpropoxy)pyridin-1-ium-4-yl]amino]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123499700 |
| Molecular Formula | C27H33N8O5+ |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 2-[[3-methoxy-1-(3-morpholin-4-ylpropoxy)pyridin-1-ium-4-yl]amino]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2cc[n+](OCCCN3CCOCC3)cc2OC)ncc1C(N)=O |
| InChI | InChI=1S/C27H32N8O5/c1-3-24(36)30-20-7-4-5-8-21(20)31-26-19(25(28)37)17-29-27(33-26)32-22-9-11-35(18-23(22)38-2)40-14-6-10-34-12-15-39-16-13-34/h3-5,7-9,11,17-18H,1,6,10,12-16H2,2H3,(H4,28,29,30,31,33,36,37)/p+1 |
| InChIKey | DAVOTZZOZRLFFQ-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|