C29H27F3N5O4S- — CID 162052260
4-[N-methyl-4-[3-methyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]butyl]anilino]-2-[3-(sulfinatoamino)anilino]pyrimidine (PubChem CID 162052260) has the molecular formula C29H27F3N5O4S- and a molecular weight of 598.63 g/mol. Its IUPAC name is 4-[N-methyl-4-[3-methyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]butyl]anilino]-2-[3-(sulfinatoamino)anilino]pyrimidine.
| Compound Name | 4-[N-methyl-4-[3-methyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]butyl]anilino]-2-[3-(sulfinatoamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 162052260 |
| Molecular Formula | C29H27F3N5O4S- |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 4-[N-methyl-4-[3-methyl-2-oxo-3-[4-(trifluoromethoxy)phenyl]butyl]anilino]-2-[3-(sulfinatoamino)anilino]pyrimidine |
| SMILES | CN(c1ccc(CC(=O)C(C)(C)c2ccc(OC(F)(F)F)cc2)cc1)c1ccnc(Nc2cccc(NS(=O)[O-])c2)n1 |
| InChI | InChI=1S/C29H28F3N5O4S/c1-28(2,20-9-13-24(14-10-20)41-29(30,31)32)25(38)17-19-7-11-23(12-8-19)37(3)26-15-16-33-27(35-26)34-21-5-4-6-22(18-21)36-42(39)40/h4-16,18,36H,17H2,1-3H3,(H,39,40)(H,33,34,35)/p-1 |
| InChIKey | ZRMXFYKPBAPYRG-UHFFFAOYSA-M |
| XLogP | 6.18 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|