C19H23N6S+ — CID 144959180
4-N-(4-aminophenyl)-2-N-[3-(dimethylaminosulfanyl)phenyl]-4-N-methylpyrimidin-1-ium-2,4-diamine (PubChem CID 144959180) has the molecular formula C19H23N6S+ and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-2-N-[3-(dimethylaminosulfanyl)phenyl]-4-N-methylpyrimidin-1-ium-2,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-2-N-[3-(dimethylaminosulfanyl)phenyl]-4-N-methylpyrimidin-1-ium-2,4-diamine |
|---|---|
| PubChem CID | 144959180 |
| Molecular Formula | C19H23N6S+ |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-N-(4-aminophenyl)-2-N-[3-(dimethylaminosulfanyl)phenyl]-4-N-methylpyrimidin-1-ium-2,4-diamine |
| SMILES | CN(C)Sc1cccc(Nc2nc(N(C)c3ccc(N)cc3)cc[nH+]2)c1 |
| InChI | InChI=1S/C19H22N6S/c1-24(2)26-17-6-4-5-15(13-17)22-19-21-12-11-18(23-19)25(3)16-9-7-14(20)8-10-16/h4-13H,20H2,1-3H3,(H,21,22,23)/p+1 |
| InChIKey | QPMLBNUURPHPDU-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 71.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|