C9H6ClFN4 — CID 172686201
4-chloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine (PubChem CID 172686201) has the molecular formula C9H6ClFN4 and a molecular weight of 224.63 g/mol. Its IUPAC name is 4-chloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 172686201 |
| Molecular Formula | C9H6ClFN4 |
| Molecular Weight | 224.63 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 4-chloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Fc1ccc(Nc2ncnc(Cl)n2)cc1 |
| InChI | InChI=1S/C9H6ClFN4/c10-8-12-5-13-9(15-8)14-7-3-1-6(11)2-4-7/h1-5H,(H,12,13,14,15) |
| InChIKey | BBLWPVGIIHOMPY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |