C11H11ClFN5O — CID 155174421
2-[5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-fluoro-4-pyridinyl]propan-2-ol (PubChem CID 155174421) has the molecular formula C11H11ClFN5O and a molecular weight of 283.69 g/mol. Its IUPAC name is 2-[5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-fluoro-4-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-fluoro-4-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 155174421 |
| Molecular Formula | C11H11ClFN5O |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-fluoro-4-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(F)ncc1Nc1ncnc(Cl)n1 |
| InChI | InChI=1S/C11H11ClFN5O/c1-11(2,19)6-3-8(13)14-4-7(6)17-10-16-5-15-9(12)18-10/h3-5,19H,1-2H3,(H,15,16,17,18) |
| InChIKey | OBVVNRKDDWUZIX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|