C8H16ClN7 — CID 88633672
2-N-(4-chloro-1,3,5-triazin-2-yl)-1-N,1-N',1-N"-trimethylethane-1,1,1,2-tetramine (PubChem CID 88633672) has the molecular formula C8H16ClN7 and a molecular weight of 245.72 g/mol. Its IUPAC name is 2-N-(4-chloro-1,3,5-triazin-2-yl)-1-N,1-N',1-N"-trimethylethane-1,1,1,2-tetramine.
| Compound Name | 2-N-(4-chloro-1,3,5-triazin-2-yl)-1-N,1-N',1-N"-trimethylethane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 88633672 |
| Molecular Formula | C8H16ClN7 |
| Molecular Weight | 245.72 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-N-(4-chloro-1,3,5-triazin-2-yl)-1-N,1-N',1-N"-trimethylethane-1,1,1,2-tetramine |
| SMILES | CNC(CNc1ncnc(Cl)n1)(NC)NC |
| InChI | InChI=1S/C8H16ClN7/c1-10-8(11-2,12-3)4-13-7-15-5-14-6(9)16-7/h5,10-12H,4H2,1-3H3,(H,13,14,15,16) |
| InChIKey | ZHAUKOZTMZKNRG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.72 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|