C21H23N6O3P — CID 118129146
N-[3-[[6-[(3-dimethylphosphoryl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 118129146) has the molecular formula C21H23N6O3P and a molecular weight of 438.43 g/mol. Its IUPAC name is N-[3-[[6-[(3-dimethylphosphoryl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[[6-[(3-dimethylphosphoryl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118129146 |
| Molecular Formula | C21H23N6O3P |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[3-[[6-[(3-dimethylphosphoryl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)c(Nc2cc(Nc3ncccc3P(C)(C)=O)ncn2)c1 |
| InChI | InChI=1S/C21H23N6O3P/c1-5-20(28)25-14-8-9-16(30-2)15(11-14)26-18-12-19(24-13-23-18)27-21-17(31(3,4)29)7-6-10-22-21/h5-13H,1H2,2-4H3,(H,25,28)(H2,22,23,24,26,27) |
| InChIKey | XTOXCPRCMDKLGF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|