C17H20N7OP — CID 168859231
4-N-(3-dimethylphosphoryl-2-pyridinyl)-6-N-(2,6-dimethylpyrimidin-4-yl)pyrimidine-4,6-diamine (PubChem CID 168859231) has the molecular formula C17H20N7OP and a molecular weight of 369.37 g/mol. Its IUPAC name is 4-N-(3-dimethylphosphoryl-2-pyridinyl)-6-N-(2,6-dimethylpyrimidin-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-dimethylphosphoryl-2-pyridinyl)-6-N-(2,6-dimethylpyrimidin-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 168859231 |
| Molecular Formula | C17H20N7OP |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-N-(3-dimethylphosphoryl-2-pyridinyl)-6-N-(2,6-dimethylpyrimidin-4-yl)pyrimidine-4,6-diamine |
| SMILES | Cc1cc(Nc2cc(Nc3ncccc3P(C)(C)=O)ncn2)nc(C)n1 |
| InChI | InChI=1S/C17H20N7OP/c1-11-8-16(22-12(2)21-11)23-14-9-15(20-10-19-14)24-17-13(26(3,4)25)6-5-7-18-17/h5-10H,1-4H3,(H2,18,19,20,21,22,23,24) |
| InChIKey | RFZJKUNZSQILLP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|