C29H20F4N6O2 — CID 171614597
N-[2-[[5-fluoro-2-[[(3Z)-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylidene]-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 171614597) has the molecular formula C29H20F4N6O2 and a molecular weight of 560.51 g/mol. Its IUPAC name is N-[2-[[5-fluoro-2-[[(3Z)-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylidene]-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-fluoro-2-[[(3Z)-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylidene]-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171614597 |
| Molecular Formula | C29H20F4N6O2 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | N-[2-[[5-fluoro-2-[[(3Z)-2-oxo-3-[[2-(trifluoromethyl)phenyl]methylidene]-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc3c(c2)/C(=C/c2ccccc2C(F)(F)F)C(=O)N3)ncc1F |
| InChI | InChI=1S/C29H20F4N6O2/c1-2-25(40)36-23-9-5-6-10-24(23)37-26-21(30)15-34-28(39-26)35-17-11-12-22-18(14-17)19(27(41)38-22)13-16-7-3-4-8-20(16)29(31,32)33/h2-15H,1H2,(H,36,40)(H,38,41)(H2,34,35,37,39)/b19-13- |
| InChIKey | APPFAINPGRZAIJ-UYRXBGFRSA-N |
| XLogP | 6.74 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|