C22H18N8O — CID 167981173
1-[4-(benzotriazol-1-yl)phenyl]-3-[3-(1-methyltriazol-4-yl)phenyl]urea (PubChem CID 167981173) has the molecular formula C22H18N8O and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-[4-(benzotriazol-1-yl)phenyl]-3-[3-(1-methyltriazol-4-yl)phenyl]urea.
| Compound Name | 1-[4-(benzotriazol-1-yl)phenyl]-3-[3-(1-methyltriazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 167981173 |
| Molecular Formula | C22H18N8O |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[4-(benzotriazol-1-yl)phenyl]-3-[3-(1-methyltriazol-4-yl)phenyl]urea |
| SMILES | Cn1cc(-c2cccc(NC(=O)Nc3ccc(-n4nnc5ccccc54)cc3)c2)nn1 |
| InChI | InChI=1S/C22H18N8O/c1-29-14-20(26-27-29)15-5-4-6-17(13-15)24-22(31)23-16-9-11-18(12-10-16)30-21-8-3-2-7-19(21)25-28-30/h2-14H,1H3,(H2,23,24,31) |
| InChIKey | NCUBPXMRUYTQBD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |