C30H33FN6O4Si — CID 175415712
4-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-5-[4-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxamide (PubChem CID 175415712) has the molecular formula C30H33FN6O4Si and a molecular weight of 588.72 g/mol. Its IUPAC name is 4-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-5-[4-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxamide.
| Compound Name | 4-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-5-[4-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175415712 |
| Molecular Formula | C30H33FN6O4Si |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 4-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-5-[4-(prop-2-enoylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxamide |
| SMILES | C=CC(=O)Nc1ccc(-c2c(-c3ccc(Oc4nccc(C)n4)c(F)c3)c(C(N)=O)nn2COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C30H33FN6O4Si/c1-6-25(38)35-22-10-7-20(8-11-22)28-26(27(29(32)39)36-37(28)18-40-15-16-42(3,4)5)21-9-12-24(23(31)17-21)41-30-33-14-13-19(2)34-30/h6-14,17H,1,15-16,18H2,2-5H3,(H2,32,39)(H,35,38) |
| InChIKey | XAUNVQZQPXFKCU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|