C14H20INO4Si — CID 176901327
6-iodo-5-methoxy-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one (PubChem CID 176901327) has the molecular formula C14H20INO4Si and a molecular weight of 421.31 g/mol. Its IUPAC name is 6-iodo-5-methoxy-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one.
| Compound Name | 6-iodo-5-methoxy-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 176901327 |
| Molecular Formula | C14H20INO4Si |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 6-iodo-5-methoxy-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
| SMILES | COc1cc2c(cc1I)oc(=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H20INO4Si/c1-18-12-8-11-13(7-10(12)15)20-14(17)16(11)9-19-5-6-21(2,3)4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | UJTTTZHULXWVSS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|