C38H42FN5O5Si — CID 163290826
6-[2-amino-5-[bis[(4-methoxyphenyl)methyl]amino]-6-fluoroquinazolin-7-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one (PubChem CID 163290826) has the molecular formula C38H42FN5O5Si and a molecular weight of 695.87 g/mol. Its IUPAC name is 6-[2-amino-5-[bis[(4-methoxyphenyl)methyl]amino]-6-fluoroquinazolin-7-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-amino-5-[bis[(4-methoxyphenyl)methyl]amino]-6-fluoroquinazolin-7-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 163290826 |
| Molecular Formula | C38H42FN5O5Si |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.29 |
| IUPAC Name | 6-[2-amino-5-[bis[(4-methoxyphenyl)methyl]amino]-6-fluoroquinazolin-7-yl]-5-methyl-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2c(F)c(-c3cc4oc(=O)n(COCC[Si](C)(C)C)c4cc3C)cc3nc(N)ncc23)cc1 |
| InChI | InChI=1S/C38H42FN5O5Si/c1-24-17-33-34(49-38(45)44(33)23-48-15-16-50(4,5)6)19-29(24)30-18-32-31(20-41-37(40)42-32)36(35(30)39)43(21-25-7-11-27(46-2)12-8-25)22-26-9-13-28(47-3)14-10-26/h7-14,17-20H,15-16,21-23H2,1-6H3,(H2,40,41,42) |
| InChIKey | OCEKFALKWDDRAT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|