C15H13N5OS — CID 170973127
7-[(4-methoxyphenyl)methyl]-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-10-amine (PubChem CID 170973127) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 7-[(4-methoxyphenyl)methyl]-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-10-amine.
| Compound Name | 7-[(4-methoxyphenyl)methyl]-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-10-amine |
|---|---|
| PubChem CID | 170973127 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 7-[(4-methoxyphenyl)methyl]-3-thia-4,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-10-amine |
| SMILES | COc1ccc(Cn2c3cnsc3c3cnc(N)nc32)cc1 |
| InChI | InChI=1S/C15H13N5OS/c1-21-10-4-2-9(3-5-10)8-20-12-7-18-22-13(12)11-6-17-15(16)19-14(11)20/h2-7H,8H2,1H3,(H2,16,17,19) |
| InChIKey | SNPQHJQXCUUPLN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |