C15H14BrN3O — CID 43661463
5-bromo-1-[(4-methoxyphenyl)methyl]benzimidazol-2-amine (PubChem CID 43661463) has the molecular formula C15H14BrN3O and a molecular weight of 332.20 g/mol. Its IUPAC name is 5-bromo-1-[(4-methoxyphenyl)methyl]benzimidazol-2-amine.
| Compound Name | 5-bromo-1-[(4-methoxyphenyl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 43661463 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-bromo-1-[(4-methoxyphenyl)methyl]benzimidazol-2-amine |
| SMILES | COc1ccc(Cn2c(N)nc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C15H14BrN3O/c1-20-12-5-2-10(3-6-12)9-19-14-7-4-11(16)8-13(14)18-15(19)17/h2-8H,9H2,1H3,(H2,17,18) |
| InChIKey | LBRNESFMWWRSLQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |