C16H15Br2N3 — CID 21484267
1-[(3,5-dibromophenyl)methyl]-5,6-dimethylbenzimidazol-2-amine (PubChem CID 21484267) has the molecular formula C16H15Br2N3 and a molecular weight of 409.13 g/mol. Its IUPAC name is 1-[(3,5-dibromophenyl)methyl]-5,6-dimethylbenzimidazol-2-amine.
| Compound Name | 1-[(3,5-dibromophenyl)methyl]-5,6-dimethylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 21484267 |
| Molecular Formula | C16H15Br2N3 |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 1-[(3,5-dibromophenyl)methyl]-5,6-dimethylbenzimidazol-2-amine |
| SMILES | Cc1cc2nc(N)n(Cc3cc(Br)cc(Br)c3)c2cc1C |
| InChI | InChI=1S/C16H15Br2N3/c1-9-3-14-15(4-10(9)2)21(16(19)20-14)8-11-5-12(17)7-13(18)6-11/h3-7H,8H2,1-2H3,(H2,19,20) |
| InChIKey | MAWQIKTUIOSCGK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |