C17H16N4 — CID 82359067
4-[(2-amino-5,6-dimethylbenzimidazol-1-yl)methyl]benzonitrile (PubChem CID 82359067) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[(2-amino-5,6-dimethylbenzimidazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(2-amino-5,6-dimethylbenzimidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 82359067 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-[(2-amino-5,6-dimethylbenzimidazol-1-yl)methyl]benzonitrile |
| SMILES | Cc1cc2nc(N)n(Cc3ccc(C#N)cc3)c2cc1C |
| InChI | InChI=1S/C17H16N4/c1-11-7-15-16(8-12(11)2)21(17(19)20-15)10-14-5-3-13(9-18)4-6-14/h3-8H,10H2,1-2H3,(H2,19,20) |
| InChIKey | XCFWKVILNLAXHU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |