C17H13Cl2N3 — CID 39158119
4-[(5,6-dichloro-2-ethylbenzimidazol-1-yl)methyl]benzonitrile (PubChem CID 39158119) has the molecular formula C17H13Cl2N3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 4-[(5,6-dichloro-2-ethylbenzimidazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(5,6-dichloro-2-ethylbenzimidazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 39158119 |
| Molecular Formula | C17H13Cl2N3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-[(5,6-dichloro-2-ethylbenzimidazol-1-yl)methyl]benzonitrile |
| SMILES | CCc1nc2cc(Cl)c(Cl)cc2n1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H13Cl2N3/c1-2-17-21-15-7-13(18)14(19)8-16(15)22(17)10-12-5-3-11(9-20)4-6-12/h3-8H,2,10H2,1H3 |
| InChIKey | SMMTVRPWOBOBHO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |