C37H39Cl2F5N4O4Si — CID 165406098
7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-3-(2-trimethylsilylethoxymethyl)-2H-quinazolin-4-one (PubChem CID 165406098) has the molecular formula C37H39Cl2F5N4O4Si and a molecular weight of 797.72 g/mol. Its IUPAC name is 7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-3-(2-trimethylsilylethoxymethyl)-2H-quinazolin-4-one.
| Compound Name | 7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-3-(2-trimethylsilylethoxymethyl)-2H-quinazolin-4-one |
|---|---|
| PubChem CID | 165406098 |
| Molecular Formula | C37H39Cl2F5N4O4Si |
| Molecular Weight | 797.72 g/mol |
| Exact Mass | 796.20 |
| IUPAC Name | 7-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-2,6-dichloro-5,6-difluoro-3-(2-trimethylsilylethoxymethyl)-2H-quinazolin-4-one |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(C)c(C(F)(F)F)c(C3=CC4=NC(Cl)N(COCC[Si](C)(C)C)C(=O)C4=C(F)C3(F)Cl)n2)cc1 |
| InChI | InChI=1S/C37H39Cl2F5N4O4Si/c1-22-17-29(47(19-23-7-11-25(50-2)12-8-23)20-24-9-13-26(51-3)14-10-24)46-32(31(22)37(42,43)44)27-18-28-30(33(40)36(27,39)41)34(49)48(35(38)45-28)21-52-15-16-53(4,5)6/h7-14,17-18,35H,15-16,19-21H2,1-6H3 |
| InChIKey | PNFRJBUVNXIWLK-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 76.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.72 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|