C26H26F3N3O2S — CID 172588417
3-[[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanenitrile (PubChem CID 172588417) has the molecular formula C26H26F3N3O2S and a molecular weight of 501.57 g/mol. Its IUPAC name is 3-[[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanenitrile.
| Compound Name | 3-[[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 172588417 |
| Molecular Formula | C26H26F3N3O2S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 3-[[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanenitrile |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(C)c(C(F)(F)F)c(SCCC#N)n2)cc1 |
| InChI | InChI=1S/C26H26F3N3O2S/c1-18-15-23(31-25(35-14-4-13-30)24(18)26(27,28)29)32(16-19-5-9-21(33-2)10-6-19)17-20-7-11-22(34-3)12-8-20/h5-12,15H,4,14,16-17H2,1-3H3 |
| InChIKey | VRSTVGXYKOVWDD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|