C30H26ClF5N4O3 — CID 164875811
2-amino-4-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-chloro-3,6-difluorobenzamide (PubChem CID 164875811) has the molecular formula C30H26ClF5N4O3 and a molecular weight of 621.01 g/mol. Its IUPAC name is 2-amino-4-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-chloro-3,6-difluorobenzamide.
| Compound Name | 2-amino-4-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-chloro-3,6-difluorobenzamide |
|---|---|
| PubChem CID | 164875811 |
| Molecular Formula | C30H26ClF5N4O3 |
| Molecular Weight | 621.01 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 2-amino-4-[6-[bis[(4-methoxyphenyl)methyl]amino]-4-methyl-3-(trifluoromethyl)-2-pyridinyl]-5-chloro-3,6-difluorobenzamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(C)c(C(F)(F)F)c(-c3c(F)c(N)c(C(N)=O)c(F)c3Cl)n2)cc1 |
| InChI | InChI=1S/C30H26ClF5N4O3/c1-15-12-20(40(13-16-4-8-18(42-2)9-5-16)14-17-6-10-19(43-3)11-7-17)39-28(23(15)30(34,35)36)21-24(31)25(32)22(29(38)41)27(37)26(21)33/h4-12H,13-14,37H2,1-3H3,(H2,38,41) |
| InChIKey | IXFDTXTYUZJLRA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|