C38H45IN4O4Si — CID 166460532
N-[[5-[bis[(4-methoxyphenyl)methyl]amino]-3-iodo-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]benzamide (PubChem CID 166460532) has the molecular formula C38H45IN4O4Si and a molecular weight of 776.79 g/mol. Its IUPAC name is N-[[5-[bis[(4-methoxyphenyl)methyl]amino]-3-iodo-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]benzamide.
| Compound Name | N-[[5-[bis[(4-methoxyphenyl)methyl]amino]-3-iodo-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 166460532 |
| Molecular Formula | C38H45IN4O4Si |
| Molecular Weight | 776.79 g/mol |
| Exact Mass | 776.23 |
| IUPAC Name | N-[[5-[bis[(4-methoxyphenyl)methyl]amino]-3-iodo-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]benzamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc3c(I)c(CNC(=O)c4ccccc4)n(COCC[Si](C)(C)C)c3cc2C)cc1 |
| InChI | InChI=1S/C38H45IN4O4Si/c1-27-22-33-36(35(39)34(43(33)26-47-20-21-48(4,5)6)23-40-38(44)30-10-8-7-9-11-30)41-37(27)42(24-28-12-16-31(45-2)17-13-28)25-29-14-18-32(46-3)19-15-29/h7-19,22H,20-21,23-26H2,1-6H3,(H,40,44) |
| InChIKey | HZOIRFUGBPAFPK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.79 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|