C31H43N3O4 — CID 66941388
tert-butyl N-[1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-5-(dipropylamino)pentan-2-yl]carbamate (PubChem CID 66941388) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-5-(dipropylamino)pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-5-(dipropylamino)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 66941388 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | tert-butyl N-[1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-5-(dipropylamino)pentan-2-yl]carbamate |
| SMILES | CCCN(CCC)CCCC(Cc1ccc(CN2C(=O)c3ccccc3C2=O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H43N3O4/c1-6-18-33(19-7-2)20-10-11-25(32-30(37)38-31(3,4)5)21-23-14-16-24(17-15-23)22-34-28(35)26-12-8-9-13-27(26)29(34)36/h8-9,12-17,25H,6-7,10-11,18-22H2,1-5H3,(H,32,37) |
| InChIKey | YHDZHFKQHRWANA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|