C22H37N3O3 — CID 69432216
tert-butyl N-[(2R)-5-[2-(diethylamino)ethylamino]-5-oxo-1-phenylpentan-2-yl]carbamate (PubChem CID 69432216) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-[2-(diethylamino)ethylamino]-5-oxo-1-phenylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-[2-(diethylamino)ethylamino]-5-oxo-1-phenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 69432216 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | tert-butyl N-[(2R)-5-[2-(diethylamino)ethylamino]-5-oxo-1-phenylpentan-2-yl]carbamate |
| SMILES | CCN(CC)CCNC(=O)CC[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37N3O3/c1-6-25(7-2)16-15-23-20(26)14-13-19(17-18-11-9-8-10-12-18)24-21(27)28-22(3,4)5/h8-12,19H,6-7,13-17H2,1-5H3,(H,23,26)(H,24,27)/t19-/m1/s1 |
| InChIKey | ZQHRRQPVUMKHIT-LJQANCHMSA-N |
| XLogP | 3.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |