C19H16FN3O5 — CID 174189079
[1-(4-carbamoyl-3-fluorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid (PubChem CID 174189079) has the molecular formula C19H16FN3O5 and a molecular weight of 385.35 g/mol. Its IUPAC name is [1-(4-carbamoyl-3-fluorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid.
| Compound Name | [1-(4-carbamoyl-3-fluorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174189079 |
| Molecular Formula | C19H16FN3O5 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [1-(4-carbamoyl-3-fluorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]carbamic acid |
| SMILES | NC(=O)c1ccc(CC(CN2C(=O)c3ccccc3C2=O)NC(=O)O)cc1F |
| InChI | InChI=1S/C19H16FN3O5/c20-15-8-10(5-6-14(15)16(21)24)7-11(22-19(27)28)9-23-17(25)12-3-1-2-4-13(12)18(23)26/h1-6,8,11,22H,7,9H2,(H2,21,24)(H,27,28) |
| InChIKey | WMZQCTBUXCOKCW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|