C33H25N3O3S — CID 142384366
N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-2-(5-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 142384366) has the molecular formula C33H25N3O3S and a molecular weight of 543.65 g/mol. Its IUPAC name is N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-2-(5-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-2-(5-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 142384366 |
| Molecular Formula | C33H25N3O3S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | N-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-2-(5-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)CN1C(=O)c2ccccc2C1=O)c1ccccc1-c1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C33H25N3O3S/c37-30(25-15-7-8-16-26(25)31-34-20-29(40-31)23-13-5-2-6-14-23)35-24(19-22-11-3-1-4-12-22)21-36-32(38)27-17-9-10-18-28(27)33(36)39/h1-18,20,24H,19,21H2,(H,35,37)/t24-/m1/s1 |
| InChIKey | GGAWIFMKJPAYMM-XMMPIXPASA-N |
| XLogP | 6.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|