C28H23N5O3S — CID 173150134
1-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-3-(isoquinoline-1-carbonylamino)thiourea (PubChem CID 173150134) has the molecular formula C28H23N5O3S and a molecular weight of 509.59 g/mol. Its IUPAC name is 1-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-3-(isoquinoline-1-carbonylamino)thiourea.
| Compound Name | 1-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-3-(isoquinoline-1-carbonylamino)thiourea |
|---|---|
| PubChem CID | 173150134 |
| Molecular Formula | C28H23N5O3S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 1-[(2R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylpropan-2-yl]-3-(isoquinoline-1-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)N[C@H](Cc1ccccc1)CN1C(=O)c2ccccc2C1=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C28H23N5O3S/c34-25(24-21-11-5-4-10-19(21)14-15-29-24)31-32-28(37)30-20(16-18-8-2-1-3-9-18)17-33-26(35)22-12-6-7-13-23(22)27(33)36/h1-15,20H,16-17H2,(H,31,34)(H2,30,32,37)/t20-/m1/s1 |
| InChIKey | NRBMRWVFEDWZHN-HXUWFJFHSA-N |
| XLogP | 3.25 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|