C28H22ClN5O3S — CID 87744447
1-[1-(2-chlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea (PubChem CID 87744447) has the molecular formula C28H22ClN5O3S and a molecular weight of 544.04 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea.
| Compound Name | 1-[1-(2-chlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea |
|---|---|
| PubChem CID | 87744447 |
| Molecular Formula | C28H22ClN5O3S |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-3-(1,3-dioxoisoindol-2-yl)propan-2-yl]-3-(isoquinoline-6-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)NC(Cc1ccccc1Cl)CN1C(=O)c2ccccc2C1=O)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C28H22ClN5O3S/c29-24-8-4-1-5-18(24)14-21(16-34-26(36)22-6-2-3-7-23(22)27(34)37)31-28(38)33-32-25(35)19-9-10-20-15-30-12-11-17(20)13-19/h1-13,15,21H,14,16H2,(H,32,35)(H2,31,33,38) |
| InChIKey | SSEYRLBUPWUSNT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|