C28H19Cl2N5O2S — CID 69187346
2-[(2R)-3-(2,4-dichlorophenyl)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]propyl]isoindole-1,3-dione (PubChem CID 69187346) has the molecular formula C28H19Cl2N5O2S and a molecular weight of 560.47 g/mol. Its IUPAC name is 2-[(2R)-3-(2,4-dichlorophenyl)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-3-(2,4-dichlorophenyl)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69187346 |
| Molecular Formula | C28H19Cl2N5O2S |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | 2-[(2R)-3-(2,4-dichlorophenyl)-2-[(5-isoquinolin-6-yl-1,3,4-thiadiazol-2-yl)amino]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H](Cc1ccc(Cl)cc1Cl)Nc1nnc(-c2ccc3cnccc3c2)s1 |
| InChI | InChI=1S/C28H19Cl2N5O2S/c29-20-8-7-17(24(30)13-20)12-21(15-35-26(36)22-3-1-2-4-23(22)27(35)37)32-28-34-33-25(38-28)18-5-6-19-14-31-10-9-16(19)11-18/h1-11,13-14,21H,12,15H2,(H,32,34)/t21-/m1/s1 |
| InChIKey | IDNQDPCQJSZJOS-OAQYLSRUSA-N |
| XLogP | 6.38 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|