C28H33N5O3S — CID 173150367
tert-butyl N-cyclopropyl-N-[2-[(isoquinoline-1-carbonylamino)carbamothioylamino]-3-phenylpropyl]carbamate (PubChem CID 173150367) has the molecular formula C28H33N5O3S and a molecular weight of 519.67 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[(isoquinoline-1-carbonylamino)carbamothioylamino]-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[(isoquinoline-1-carbonylamino)carbamothioylamino]-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 173150367 |
| Molecular Formula | C28H33N5O3S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[(isoquinoline-1-carbonylamino)carbamothioylamino]-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(Cc1ccccc1)NC(=S)NNC(=O)c1nccc2ccccc12)C1CC1 |
| InChI | InChI=1S/C28H33N5O3S/c1-28(2,3)36-27(35)33(22-13-14-22)18-21(17-19-9-5-4-6-10-19)30-26(37)32-31-25(34)24-23-12-8-7-11-20(23)15-16-29-24/h4-12,15-16,21-22H,13-14,17-18H2,1-3H3,(H,31,34)(H2,30,32,37) |
| InChIKey | LRQNFNAPDZZTAG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|