About 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate
2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate (PubChem CID 69007216) has the molecular formula C22H23FN2O4
and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate |
| PubChem CID | 69007216 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate |
| SMILES | CC(C)COC(=O)N[C@@H](Cc1cccc(F)c1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23FN2O4/c1-14(2)13-29-22(28)24-17(11-15-6-5-7-16(23)10-15)12-25-20(26)18-8-3-4-9-19(18)21(25)27/h3-10,14,17H,11-13H2,1-2H3,(H,24,28)/t17-/m0/s1 |
| InChIKey | OPGQPBJJXWHPTM-KRWDZBQOSA-N |
| XLogP | 3.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate?
The IUPAC name of 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate (CID 69007216) is 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate?
The canonical SMILES for 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate is CC(C)COC(=O)N[C@@H](Cc1cccc(F)c1)CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate?
The InChIKey is OPGQPBJJXWHPTM-KRWDZBQOSA-N. The full InChI is InChI=1S/C22H23FN2O4/c1-14(2)13-29-22(28)24-17(11-15-6-5-7-16(23)10-15)12-25-20(26)18-8-3-4-9-19(18)21(25)27/h3-10,14,17H,11-13H2,1-2H3,(H,24,28)/t17-/m0/s1.
What are the key properties of 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate?
2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate has a molecular weight of 398.43 g/mol, XLogP of 3.42, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[(2S)-1-(1,3-dioxoisoindol-2-yl)-3-(3-fluorophenyl)propan-2-yl]carbamate is sourced from PubChem (CID 69007216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).