C14H16N2O4 — CID 150921209
[(2R)-1-(1,3-dioxoisoindol-2-yl)pentan-2-yl]carbamic acid (PubChem CID 150921209) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(2R)-1-(1,3-dioxoisoindol-2-yl)pentan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-(1,3-dioxoisoindol-2-yl)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 150921209 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(2R)-1-(1,3-dioxoisoindol-2-yl)pentan-2-yl]carbamic acid |
| SMILES | CCC[C@H](CN1C(=O)c2ccccc2C1=O)NC(=O)O |
| InChI | InChI=1S/C14H16N2O4/c1-2-5-9(15-14(19)20)8-16-12(17)10-6-3-4-7-11(10)13(16)18/h3-4,6-7,9,15H,2,5,8H2,1H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | LEBKURDYFAARCN-SECBINFHSA-N |
| XLogP | 1.72 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|