C25H25N3O7 — CID 23374867
2-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-ylamino]-2-butoxyacetic acid (PubChem CID 23374867) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is 2-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-ylamino]-2-butoxyacetic acid.
| Compound Name | 2-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-ylamino]-2-butoxyacetic acid |
|---|---|
| PubChem CID | 23374867 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-ylamino]-2-butoxyacetic acid |
| SMILES | CCCCOC(NC(CN1C(=O)c2ccccc2C1=O)CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C25H25N3O7/c1-2-3-12-35-20(25(33)34)26-15(13-27-21(29)16-8-4-5-9-17(16)22(27)30)14-28-23(31)18-10-6-7-11-19(18)24(28)32/h4-11,15,20,26H,2-3,12-14H2,1H3,(H,33,34) |
| InChIKey | LKOWCZRXPVJITI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|