C28H38O3Si — CID 101366608
[(2S)-1-phenylpent-4-en-2-yl] (Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylpent-3-enoate (PubChem CID 101366608) has the molecular formula C28H38O3Si and a molecular weight of 450.70 g/mol. Its IUPAC name is [(2S)-1-phenylpent-4-en-2-yl] (Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylpent-3-enoate.
| Compound Name | [(2S)-1-phenylpent-4-en-2-yl] (Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylpent-3-enoate |
|---|---|
| PubChem CID | 101366608 |
| Molecular Formula | C28H38O3Si |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(2S)-1-phenylpent-4-en-2-yl] (Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylpent-3-enoate |
| SMILES | C=CC[C@@H](Cc1ccccc1)OC(=O)C/C(O[Si](C)(C)C(C)(C)C)=C(\C)c1ccccc1 |
| InChI | InChI=1S/C28H38O3Si/c1-8-15-25(20-23-16-11-9-12-17-23)30-27(29)21-26(31-32(6,7)28(3,4)5)22(2)24-18-13-10-14-19-24/h8-14,16-19,25H,1,15,20-21H2,2-7H3/b26-22-/t25-/m0/s1 |
| InChIKey | RZKABQPGPDPLNX-DWCUFGPVSA-N |
| XLogP | 7.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|