C28H36O5Si — CID 134813788
dibenzyl 2-[(3S)-2-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dien-3-yl]propanedioate (PubChem CID 134813788) has the molecular formula C28H36O5Si and a molecular weight of 480.68 g/mol. Its IUPAC name is dibenzyl 2-[(3S)-2-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dien-3-yl]propanedioate.
| Compound Name | dibenzyl 2-[(3S)-2-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dien-3-yl]propanedioate |
|---|---|
| PubChem CID | 134813788 |
| Molecular Formula | C28H36O5Si |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | dibenzyl 2-[(3S)-2-[tert-butyl(dimethyl)silyl]oxypenta-1,4-dien-3-yl]propanedioate |
| SMILES | C=C[C@H](C(=C)O[Si](C)(C)C(C)(C)C)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H36O5Si/c1-8-24(21(2)33-34(6,7)28(3,4)5)25(26(29)31-19-22-15-11-9-12-16-22)27(30)32-20-23-17-13-10-14-18-23/h8-18,24-25H,1-2,19-20H2,3-7H3/t24-/m1/s1 |
| InChIKey | HHEQGRXFERACJL-XMMPIXPASA-N |
| XLogP | 6.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|