C18H26O3Si — CID 134877348
benzyl 4-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dienoate (PubChem CID 134877348) has the molecular formula C18H26O3Si and a molecular weight of 318.49 g/mol. Its IUPAC name is benzyl 4-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dienoate.
| Compound Name | benzyl 4-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dienoate |
|---|---|
| PubChem CID | 134877348 |
| Molecular Formula | C18H26O3Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | benzyl 4-[tert-butyl(dimethyl)silyl]oxypenta-2,3-dienoate |
| SMILES | CC(=C=CC(=O)OCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H26O3Si/c1-15(21-22(5,6)18(2,3)4)12-13-17(19)20-14-16-10-8-7-9-11-16/h7-11,13H,14H2,1-6H3 |
| InChIKey | NHTCZHFZFCWYJM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|