C26H40O3Si — CID 101366607
[(2S)-1-phenylpent-4-en-2-yl] 3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylidenepropanoate (PubChem CID 101366607) has the molecular formula C26H40O3Si and a molecular weight of 428.69 g/mol. Its IUPAC name is [(2S)-1-phenylpent-4-en-2-yl] 3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylidenepropanoate.
| Compound Name | [(2S)-1-phenylpent-4-en-2-yl] 3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylidenepropanoate |
|---|---|
| PubChem CID | 101366607 |
| Molecular Formula | C26H40O3Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | [(2S)-1-phenylpent-4-en-2-yl] 3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylidenepropanoate |
| SMILES | C=CC[C@@H](Cc1ccccc1)OC(=O)CC(O[Si](C)(C)C(C)(C)C)=C1CCCCC1 |
| InChI | InChI=1S/C26H40O3Si/c1-7-14-23(19-21-15-10-8-11-16-21)28-25(27)20-24(22-17-12-9-13-18-22)29-30(5,6)26(2,3)4/h7-8,10-11,15-16,23H,1,9,12-14,17-20H2,2-6H3/t23-/m0/s1 |
| InChIKey | TYDJAWUMCILRBK-QHCPKHFHSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|