C22H27NO3 — CID 50900870
(3R)-N,N-dibenzyl-3-(methoxymethoxy)hex-5-enamide (PubChem CID 50900870) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3R)-N,N-dibenzyl-3-(methoxymethoxy)hex-5-enamide.
| Compound Name | (3R)-N,N-dibenzyl-3-(methoxymethoxy)hex-5-enamide |
|---|---|
| PubChem CID | 50900870 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3R)-N,N-dibenzyl-3-(methoxymethoxy)hex-5-enamide |
| SMILES | C=CC[C@H](CC(=O)N(Cc1ccccc1)Cc1ccccc1)OCOC |
| InChI | InChI=1S/C22H27NO3/c1-3-10-21(26-18-25-2)15-22(24)23(16-19-11-6-4-7-12-19)17-20-13-8-5-9-14-20/h3-9,11-14,21H,1,10,15-18H2,2H3/t21-/m1/s1 |
| InChIKey | BISYUSDVQHMEAG-OAQYLSRUSA-N |
| XLogP | 4.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|